C10H14N2O4 — CID 140986326
2,2-dimethylpropanoyloxymethyl 1H-imidazole-5-carboxylate (PubChem CID 140986326) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl 1H-imidazole-5-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl 1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 140986326 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl 1H-imidazole-5-carboxylate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C10H14N2O4/c1-10(2,3)9(14)16-6-15-8(13)7-4-11-5-12-7/h4-5H,6H2,1-3H3,(H,11,12) |
| InChIKey | JQPRRAWWXZXXKY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|