C15H20O5 — CID 140986692
[4-(6-methylheptyl)-2,5-dioxofuran-3-yl] prop-2-enoate (PubChem CID 140986692) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is [4-(6-methylheptyl)-2,5-dioxofuran-3-yl] prop-2-enoate.
| Compound Name | [4-(6-methylheptyl)-2,5-dioxofuran-3-yl] prop-2-enoate |
|---|---|
| PubChem CID | 140986692 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | [4-(6-methylheptyl)-2,5-dioxofuran-3-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC1=C(CCCCCC(C)C)C(=O)OC1=O |
| InChI | InChI=1S/C15H20O5/c1-4-12(16)19-13-11(14(17)20-15(13)18)9-7-5-6-8-10(2)3/h4,10H,1,5-9H2,2-3H3 |
| InChIKey | RMZKYJKOXUSGQN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|