C19H32O4 — CID 59445839
ethyl (3S,4S)-3-decyl-4-methyl-2-oxo-3,4-dihydropyran-6-carboxylate (PubChem CID 59445839) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is ethyl (3S,4S)-3-decyl-4-methyl-2-oxo-3,4-dihydropyran-6-carboxylate.
| Compound Name | ethyl (3S,4S)-3-decyl-4-methyl-2-oxo-3,4-dihydropyran-6-carboxylate |
|---|---|
| PubChem CID | 59445839 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | ethyl (3S,4S)-3-decyl-4-methyl-2-oxo-3,4-dihydropyran-6-carboxylate |
| SMILES | CCCCCCCCCC[C@@H]1C(=O)OC(C(=O)OCC)=C[C@@H]1C |
| InChI | InChI=1S/C19H32O4/c1-4-6-7-8-9-10-11-12-13-16-15(3)14-17(23-18(16)20)19(21)22-5-2/h14-16H,4-13H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | YJDDBAYOTJSZFB-HOTGVXAUSA-N |
| XLogP | 4.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|