C20H30O7 — CID 102273424
ethyl 4-[(E)-3-methoxy-3-oxoprop-1-enoxy]-2-(3-methylbutyl)-3-(2-methylpropyl)-5-oxofuran-2-carboxylate (PubChem CID 102273424) has the molecular formula C20H30O7 and a molecular weight of 382.45 g/mol. Its IUPAC name is ethyl 4-[(E)-3-methoxy-3-oxoprop-1-enoxy]-2-(3-methylbutyl)-3-(2-methylpropyl)-5-oxofuran-2-carboxylate.
| Compound Name | ethyl 4-[(E)-3-methoxy-3-oxoprop-1-enoxy]-2-(3-methylbutyl)-3-(2-methylpropyl)-5-oxofuran-2-carboxylate |
|---|---|
| PubChem CID | 102273424 |
| Molecular Formula | C20H30O7 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | ethyl 4-[(E)-3-methoxy-3-oxoprop-1-enoxy]-2-(3-methylbutyl)-3-(2-methylpropyl)-5-oxofuran-2-carboxylate |
| SMILES | CCOC(=O)C1(CCC(C)C)OC(=O)C(O/C=C/C(=O)OC)=C1CC(C)C |
| InChI | InChI=1S/C20H30O7/c1-7-25-19(23)20(10-8-13(2)3)15(12-14(4)5)17(18(22)27-20)26-11-9-16(21)24-6/h9,11,13-14H,7-8,10,12H2,1-6H3/b11-9+ |
| InChIKey | VKXWIYNQODPNCE-PKNBQFBNSA-N |
| XLogP | 3.28 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|