C28H41NO4 — CID 140986733
(3R,5S,8S,9S,10S,13R,14S,17R)-3,10,13-trimethyl-17-[2-(4-nitrophenoxy)ethyl]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 140986733) has the molecular formula C28H41NO4 and a molecular weight of 455.64 g/mol. Its IUPAC name is (3R,5S,8S,9S,10S,13R,14S,17R)-3,10,13-trimethyl-17-[2-(4-nitrophenoxy)ethyl]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5S,8S,9S,10S,13R,14S,17R)-3,10,13-trimethyl-17-[2-(4-nitrophenoxy)ethyl]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 140986733 |
| Molecular Formula | C28H41NO4 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.30 |
| IUPAC Name | (3R,5S,8S,9S,10S,13R,14S,17R)-3,10,13-trimethyl-17-[2-(4-nitrophenoxy)ethyl]-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@@]1(O)CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](CCOc4ccc([N+](=O)[O-])cc4)CC[C@@H]32)C1 |
| InChI | InChI=1S/C28H41NO4/c1-26(30)15-16-28(3)20(18-26)4-10-23-24-11-5-19(27(24,2)14-12-25(23)28)13-17-33-22-8-6-21(7-9-22)29(31)32/h6-9,19-20,23-25,30H,4-5,10-18H2,1-3H3/t19-,20+,23+,24+,25+,26-,27-,28+/m1/s1 |
| InChIKey | AMJACKFJZFFTJY-SLWGCRLHSA-N |
| XLogP | 6.77 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|