C19H23FN2O5S — CID 140987243
[3-amino-2-[[4-[(3-fluorophenyl)methoxy]phenyl]methylamino]-2-methyl-3-oxopropyl] methanesulfonate (PubChem CID 140987243) has the molecular formula C19H23FN2O5S and a molecular weight of 410.47 g/mol. Its IUPAC name is [3-amino-2-[[4-[(3-fluorophenyl)methoxy]phenyl]methylamino]-2-methyl-3-oxopropyl] methanesulfonate.
| Compound Name | [3-amino-2-[[4-[(3-fluorophenyl)methoxy]phenyl]methylamino]-2-methyl-3-oxopropyl] methanesulfonate |
|---|---|
| PubChem CID | 140987243 |
| Molecular Formula | C19H23FN2O5S |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | [3-amino-2-[[4-[(3-fluorophenyl)methoxy]phenyl]methylamino]-2-methyl-3-oxopropyl] methanesulfonate |
| SMILES | CC(COS(C)(=O)=O)(NCc1ccc(OCc2cccc(F)c2)cc1)C(N)=O |
| InChI | InChI=1S/C19H23FN2O5S/c1-19(18(21)23,13-27-28(2,24)25)22-11-14-6-8-17(9-7-14)26-12-15-4-3-5-16(20)10-15/h3-10,22H,11-13H2,1-2H3,(H2,21,23) |
| InChIKey | ILJDIDXQDBLMCZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|