About 6-hydroxy-6-(2-methylpropyl)cyclohexa-2,4-dien-1-one
6-hydroxy-6-(2-methylpropyl)cyclohexa-2,4-dien-1-one (PubChem CID 140987931) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 6-hydroxy-6-(2-methylpropyl)cyclohexa-2,4-dien-1-one.
Analyze 6-hydroxy-6-(2-methylpropyl)cyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-6-(2-methylpropyl)cyclohexa-2,4-dien-1-one?
The IUPAC name of 6-hydroxy-6-(2-methylpropyl)cyclohexa-2,4-dien-1-one (CID 140987931) is 6-hydroxy-6-(2-methylpropyl)cyclohexa-2,4-dien-1-one.
What is the SMILES notation for 6-hydroxy-6-(2-methylpropyl)cyclohexa-2,4-dien-1-one?
The canonical SMILES for 6-hydroxy-6-(2-methylpropyl)cyclohexa-2,4-dien-1-one is CC(C)CC1(O)C=CC=CC1=O.
What is the InChIKey of 6-hydroxy-6-(2-methylpropyl)cyclohexa-2,4-dien-1-one?
The InChIKey is LUPOYGVDHAVVSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-8(2)7-10(12)6-4-3-5-9(10)11/h3-6,8,12H,7H2,1-2H3.
What are the key properties of 6-hydroxy-6-(2-methylpropyl)cyclohexa-2,4-dien-1-one?
6-hydroxy-6-(2-methylpropyl)cyclohexa-2,4-dien-1-one has a molecular weight of 166.22 g/mol, XLogP of 1.46, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-6-(2-methylpropyl)cyclohexa-2,4-dien-1-one is sourced from PubChem (CID 140987931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).