C12H13N — CID 140989889
3-(cyclohexa-2,4-dien-1-ylmethyl)pyridine (PubChem CID 140989889) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is 3-(cyclohexa-2,4-dien-1-ylmethyl)pyridine.
| Compound Name | 3-(cyclohexa-2,4-dien-1-ylmethyl)pyridine |
|---|---|
| PubChem CID | 140989889 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 3-(cyclohexa-2,4-dien-1-ylmethyl)pyridine |
| SMILES | C1=CCC(Cc2cccnc2)C=C1 |
| InChI | InChI=1S/C12H13N/c1-2-5-11(6-3-1)9-12-7-4-8-13-10-12/h1-5,7-8,10-11H,6,9H2 |
| InChIKey | QKSBFOHOWZJFJQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |