C24H10Cl4F3NO2 — CID 140989930
3-chloro-4-(2-chloro-5-nitrophenyl)-2-(2,4-dichlorophenyl)-1-(2,3-difluorophenyl)-5-fluorobenzene (PubChem CID 140989930) has the molecular formula C24H10Cl4F3NO2 and a molecular weight of 543.16 g/mol. Its IUPAC name is 3-chloro-4-(2-chloro-5-nitrophenyl)-2-(2,4-dichlorophenyl)-1-(2,3-difluorophenyl)-5-fluorobenzene.
| Compound Name | 3-chloro-4-(2-chloro-5-nitrophenyl)-2-(2,4-dichlorophenyl)-1-(2,3-difluorophenyl)-5-fluorobenzene |
|---|---|
| PubChem CID | 140989930 |
| Molecular Formula | C24H10Cl4F3NO2 |
| Molecular Weight | 543.16 g/mol |
| Exact Mass | 540.94 |
| IUPAC Name | 3-chloro-4-(2-chloro-5-nitrophenyl)-2-(2,4-dichlorophenyl)-1-(2,3-difluorophenyl)-5-fluorobenzene |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(-c2c(F)cc(-c3cccc(F)c3F)c(-c3ccc(Cl)cc3Cl)c2Cl)c1 |
| InChI | InChI=1S/C24H10Cl4F3NO2/c25-11-4-6-14(18(27)8-11)21-15(13-2-1-3-19(29)24(13)31)10-20(30)22(23(21)28)16-9-12(32(33)34)5-7-17(16)26/h1-10H |
| InChIKey | PGSGCRHJDVJNBV-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.16 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|