C17H22N2 — CID 140994193
N,N-dipropyl-5,6-dihydrocyclopenta[f]isoindol-6-amine (PubChem CID 140994193) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is N,N-dipropyl-5,6-dihydrocyclopenta[f]isoindol-6-amine.
| Compound Name | N,N-dipropyl-5,6-dihydrocyclopenta[f]isoindol-6-amine |
|---|---|
| PubChem CID | 140994193 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | N,N-dipropyl-5,6-dihydrocyclopenta[f]isoindol-6-amine |
| SMILES | CCCN(CCC)C1C=c2cc3c(cc2C1)=CN=C3 |
| InChI | InChI=1S/C17H22N2/c1-3-5-19(6-4-2)17-9-13-7-15-11-18-12-16(15)8-14(13)10-17/h7-9,11-12,17H,3-6,10H2,1-2H3 |
| InChIKey | JQCKJURHOMSKDD-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |