C18H28N2 — CID 143440452
N-[(E)-4-imino-3-methylbut-2-en-2-yl]-N,3-dimethyl-1-(2-methylcyclohexa-1,3-dien-1-yl)but-2-en-1-amine (PubChem CID 143440452) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is N-[(E)-4-imino-3-methylbut-2-en-2-yl]-N,3-dimethyl-1-(2-methylcyclohexa-1,3-dien-1-yl)but-2-en-1-amine.
| Compound Name | N-[(E)-4-imino-3-methylbut-2-en-2-yl]-N,3-dimethyl-1-(2-methylcyclohexa-1,3-dien-1-yl)but-2-en-1-amine |
|---|---|
| PubChem CID | 143440452 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | N-[(E)-4-imino-3-methylbut-2-en-2-yl]-N,3-dimethyl-1-(2-methylcyclohexa-1,3-dien-1-yl)but-2-en-1-amine |
| SMILES | [H]/N=C/C(C)=C(\C)N(C)C(C=C(C)C)C1=C(C)C=CCC1 |
| InChI | InChI=1S/C18H28N2/c1-13(2)11-18(17-10-8-7-9-14(17)3)20(6)16(5)15(4)12-19/h7,9,11-12,18-19H,8,10H2,1-6H3/b16-15+,19-12+ |
| InChIKey | XESRCJGPAAUWBN-MMVWDLOFSA-N |
| XLogP | 4.86 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|