C21H30F2N2 — CID 145092298
(2E)-3-[8-(difluoromethyl)-1-methyl-2,3,4,7-tetrahydrocyclohepta[b]pyridin-6-yl]-5-methylhexa-2,4-dien-1-imine;ethane (PubChem CID 145092298) has the molecular formula C21H30F2N2 and a molecular weight of 348.48 g/mol. Its IUPAC name is (2E)-3-[8-(difluoromethyl)-1-methyl-2,3,4,7-tetrahydrocyclohepta[b]pyridin-6-yl]-5-methylhexa-2,4-dien-1-imine;ethane.
| Compound Name | (2E)-3-[8-(difluoromethyl)-1-methyl-2,3,4,7-tetrahydrocyclohepta[b]pyridin-6-yl]-5-methylhexa-2,4-dien-1-imine;ethane |
|---|---|
| PubChem CID | 145092298 |
| Molecular Formula | C21H30F2N2 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | (2E)-3-[8-(difluoromethyl)-1-methyl-2,3,4,7-tetrahydrocyclohepta[b]pyridin-6-yl]-5-methylhexa-2,4-dien-1-imine;ethane |
| SMILES | CC.[H]/N=C/C=C(\C=C(C)C)C1=CC2=C(C=C(C(F)F)C1)N(C)CCC2 |
| InChI | InChI=1S/C19H24F2N2.C2H6/c1-13(2)9-14(6-7-22)16-10-15-5-4-8-23(3)18(15)12-17(11-16)19(20)21;1-2/h6-7,9-10,12,19,22H,4-5,8,11H2,1-3H3;1-2H3/b14-6+,22-7+; |
| InChIKey | QNNJNPIYEMZVJQ-XLTGYZFQSA-N |
| XLogP | 6.06 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|