C22H25N3O4S — CID 14099523
1-[2-(2-methoxyphenoxy)ethylamino]-3-(2-methylimidazo[2,1-b][1,3]benzothiazol-8-yl)oxypropan-2-ol (PubChem CID 14099523) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenoxy)ethylamino]-3-(2-methylimidazo[2,1-b][1,3]benzothiazol-8-yl)oxypropan-2-ol.
| Compound Name | 1-[2-(2-methoxyphenoxy)ethylamino]-3-(2-methylimidazo[2,1-b][1,3]benzothiazol-8-yl)oxypropan-2-ol |
|---|---|
| PubChem CID | 14099523 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 1-[2-(2-methoxyphenoxy)ethylamino]-3-(2-methylimidazo[2,1-b][1,3]benzothiazol-8-yl)oxypropan-2-ol |
| SMILES | COc1ccccc1OCCNCC(O)COc1cccc2sc3nc(C)cn3c12 |
| InChI | InChI=1S/C22H25N3O4S/c1-15-13-25-21-19(8-5-9-20(21)30-22(25)24-15)29-14-16(26)12-23-10-11-28-18-7-4-3-6-17(18)27-2/h3-9,13,16,23,26H,10-12,14H2,1-2H3 |
| InChIKey | YYGDIPXGMSOEIR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|