C16H28N2O6 — CID 140995726
(2S,7S)-2,7-bis(tert-butylamino)-3,6-dioxooctanedioic acid (PubChem CID 140995726) has the molecular formula C16H28N2O6 and a molecular weight of 344.41 g/mol. Its IUPAC name is (2S,7S)-2,7-bis(tert-butylamino)-3,6-dioxooctanedioic acid.
| Compound Name | (2S,7S)-2,7-bis(tert-butylamino)-3,6-dioxooctanedioic acid |
|---|---|
| PubChem CID | 140995726 |
| Molecular Formula | C16H28N2O6 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | (2S,7S)-2,7-bis(tert-butylamino)-3,6-dioxooctanedioic acid |
| SMILES | CC(C)(C)N[C@H](C(=O)O)C(=O)CCC(=O)[C@H](NC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C16H28N2O6/c1-15(2,3)17-11(13(21)22)9(19)7-8-10(20)12(14(23)24)18-16(4,5)6/h11-12,17-18H,7-8H2,1-6H3,(H,21,22)(H,23,24)/t11-,12-/m0/s1 |
| InChIKey | ZSKWHELQTOUKQA-RYUDHWBXSA-N |
| XLogP | 0.59 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|