C14H22S2 — CID 140997209
(2,4,4-trimethylpentan-2-yldisulfanyl)benzene (PubChem CID 140997209) has the molecular formula C14H22S2 and a molecular weight of 254.46 g/mol. Its IUPAC name is (2,4,4-trimethylpentan-2-yldisulfanyl)benzene.
| Compound Name | (2,4,4-trimethylpentan-2-yldisulfanyl)benzene |
|---|---|
| PubChem CID | 140997209 |
| Molecular Formula | C14H22S2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (2,4,4-trimethylpentan-2-yldisulfanyl)benzene |
| SMILES | CC(C)(C)CC(C)(C)SSc1ccccc1 |
| InChI | InChI=1S/C14H22S2/c1-13(2,3)11-14(4,5)16-15-12-9-7-6-8-10-12/h6-10H,11H2,1-5H3 |
| InChIKey | KGWDQBUBVVAQQZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|