2,3-dihydroxybicyclo[2.2.1]heptane-1-carboxylic acid

C8H12O4 — CID 140997258

IUPAC2,3-dihydroxybicyclo[2.2.1]heptane-1-carboxylic acid
SMILESO=C(O)C12CCC(C1)C(O)C2O
InChIInChI=1S/C8H12O4/c9-5-4-1-2-8(3-4,6(5)10)7(11)12/h4-6,9-10H,1-3H2,(H,11,12)
InChIKeyAYJJHVRKJUYNDB-UHFFFAOYSA-N
MW172.18 g/mol
LogP-0.41
Rot. Bonds1

About 2,3-dihydroxybicyclo[2.2.1]heptane-1-carboxylic acid

2,3-dihydroxybicyclo[2.2.1]heptane-1-carboxylic acid (PubChem CID 140997258) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is 2,3-dihydroxybicyclo[2.2.1]heptane-1-carboxylic acid.

Molecular Properties

Compound Name2,3-dihydroxybicyclo[2.2.1]heptane-1-carboxylic acid
PubChem CID140997258
Molecular FormulaC8H12O4
Molecular Weight172.18 g/mol
Exact Mass172.07
IUPAC Name2,3-dihydroxybicyclo[2.2.1]heptane-1-carboxylic acid
SMILESO=C(O)C12CCC(C1)C(O)C2O
InChIInChI=1S/C8H12O4/c9-5-4-1-2-8(3-4,6(5)10)7(11)12/h4-6,9-10H,1-3H2,(H,11,12)
InChIKeyAYJJHVRKJUYNDB-UHFFFAOYSA-N
XLogP-0.41
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.18
LogP ≤ 5-0.41
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2,3-dihydroxybicyclo[2.2.1]heptane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihydroxybicyclo[2.2.1]heptane-1-carboxylic acid?
The IUPAC name of 2,3-dihydroxybicyclo[2.2.1]heptane-1-carboxylic acid (CID 140997258) is 2,3-dihydroxybicyclo[2.2.1]heptane-1-carboxylic acid.
What is the SMILES notation for 2,3-dihydroxybicyclo[2.2.1]heptane-1-carboxylic acid?
The canonical SMILES for 2,3-dihydroxybicyclo[2.2.1]heptane-1-carboxylic acid is O=C(O)C12CCC(C1)C(O)C2O.
What is the InChIKey of 2,3-dihydroxybicyclo[2.2.1]heptane-1-carboxylic acid?
The InChIKey is AYJJHVRKJUYNDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4/c9-5-4-1-2-8(3-4,6(5)10)7(11)12/h4-6,9-10H,1-3H2,(H,11,12).
What are the key properties of 2,3-dihydroxybicyclo[2.2.1]heptane-1-carboxylic acid?
2,3-dihydroxybicyclo[2.2.1]heptane-1-carboxylic acid has a molecular weight of 172.18 g/mol, XLogP of -0.41, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxybicyclo[2.2.1]heptane-1-carboxylic acid is sourced from PubChem (CID 140997258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).