C14H21NO3S — CID 140997924
2-piperidin-2-ylethyl phenylmethanesulfonate (PubChem CID 140997924) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 2-piperidin-2-ylethyl phenylmethanesulfonate.
| Compound Name | 2-piperidin-2-ylethyl phenylmethanesulfonate |
|---|---|
| PubChem CID | 140997924 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-piperidin-2-ylethyl phenylmethanesulfonate |
| SMILES | O=S(=O)(Cc1ccccc1)OCCC1CCCCN1 |
| InChI | InChI=1S/C14H21NO3S/c16-19(17,12-13-6-2-1-3-7-13)18-11-9-14-8-4-5-10-15-14/h1-3,6-7,14-15H,4-5,8-12H2 |
| InChIKey | QPNUJIIWRIWGJK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|