C28H34 — CID 140998182
7-but-1-enyl-6-but-1-ynyl-8-ethenyl-6-ethynyl-7-prop-1-enyltridec-9-en-2,4-diyne (PubChem CID 140998182) has the molecular formula C28H34 and a molecular weight of 370.58 g/mol. Its IUPAC name is 7-but-1-enyl-6-but-1-ynyl-8-ethenyl-6-ethynyl-7-prop-1-enyltridec-9-en-2,4-diyne.
| Compound Name | 7-but-1-enyl-6-but-1-ynyl-8-ethenyl-6-ethynyl-7-prop-1-enyltridec-9-en-2,4-diyne |
|---|---|
| PubChem CID | 140998182 |
| Molecular Formula | C28H34 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | 7-but-1-enyl-6-but-1-ynyl-8-ethenyl-6-ethynyl-7-prop-1-enyltridec-9-en-2,4-diyne |
| SMILES | C#CC(C#CC#CC)(C#CCC)C(C=CC)(C=CCC)C(C=C)C=CCCC |
| InChI | InChI=1S/C28H34/c1-8-15-19-21-26(13-6)28(22-12-5,25-18-11-4)27(14-7,23-17-10-3)24-20-16-9-2/h7,12-13,18-19,21-22,25-26H,6,8,10-11,15H2,1-5H3 |
| InChIKey | VBFQAVPUQZSLQR-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|