C20H25NO6 — CID 140998941
2-ethylhexyl 4-[(4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate (PubChem CID 140998941) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is 2-ethylhexyl 4-[(4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate.
| Compound Name | 2-ethylhexyl 4-[(4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate |
|---|---|
| PubChem CID | 140998941 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-ethylhexyl 4-[(4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate |
| SMILES | CCCCC(CC)COC(=O)c1ccc(NC=C2C(=O)OCOC2=O)cc1 |
| InChI | InChI=1S/C20H25NO6/c1-3-5-6-14(4-2)12-25-18(22)15-7-9-16(10-8-15)21-11-17-19(23)26-13-27-20(17)24/h7-11,14,21H,3-6,12-13H2,1-2H3 |
| InChIKey | ZARVDTZGJXFYMN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|