C38H52N6O4 — CID 145093183
2-ethylhexyl 4-[[4-[4-(2-ethylhexoxycarbonyl)anilino]-6-[[(2E)-penta-2,4-dien-2-yl]amino]-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 145093183) has the molecular formula C38H52N6O4 and a molecular weight of 656.87 g/mol. Its IUPAC name is 2-ethylhexyl 4-[[4-[4-(2-ethylhexoxycarbonyl)anilino]-6-[[(2E)-penta-2,4-dien-2-yl]amino]-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | 2-ethylhexyl 4-[[4-[4-(2-ethylhexoxycarbonyl)anilino]-6-[[(2E)-penta-2,4-dien-2-yl]amino]-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 145093183 |
| Molecular Formula | C38H52N6O4 |
| Molecular Weight | 656.87 g/mol |
| Exact Mass | 656.41 |
| IUPAC Name | 2-ethylhexyl 4-[[4-[4-(2-ethylhexoxycarbonyl)anilino]-6-[[(2E)-penta-2,4-dien-2-yl]amino]-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | C=C/C=C(\C)Nc1nc(Nc2ccc(C(=O)OCC(CC)CCCC)cc2)nc(Nc2ccc(C(=O)OCC(CC)CCCC)cc2)n1 |
| InChI | InChI=1S/C38H52N6O4/c1-7-12-15-28(10-4)25-47-34(45)30-17-21-32(22-18-30)40-37-42-36(39-27(6)14-9-3)43-38(44-37)41-33-23-19-31(20-24-33)35(46)48-26-29(11-5)16-13-8-2/h9,14,17-24,28-29H,3,7-8,10-13,15-16,25-26H2,1-2,4-6H3,(H3,39,40,41,42,43,44)/b27-14+ |
| InChIKey | VIWGNPYXAGDPRV-MZJWZYIUSA-N |
| XLogP | 9.61 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.87 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|