C50H64N8O8 — CID 58607396
2-ethylhexyl 4-[[4,6-bis[4-[(E)-2-(tert-butylcarbamoyl)-3-ethoxy-3-oxoprop-1-enyl]anilino]-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 58607396) has the molecular formula C50H64N8O8 and a molecular weight of 905.11 g/mol. Its IUPAC name is 2-ethylhexyl 4-[[4,6-bis[4-[(E)-2-(tert-butylcarbamoyl)-3-ethoxy-3-oxoprop-1-enyl]anilino]-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | 2-ethylhexyl 4-[[4,6-bis[4-[(E)-2-(tert-butylcarbamoyl)-3-ethoxy-3-oxoprop-1-enyl]anilino]-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 58607396 |
| Molecular Formula | C50H64N8O8 |
| Molecular Weight | 905.11 g/mol |
| Exact Mass | 904.48 |
| IUPAC Name | 2-ethylhexyl 4-[[4,6-bis[4-[(E)-2-(tert-butylcarbamoyl)-3-ethoxy-3-oxoprop-1-enyl]anilino]-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CCCCC(CC)COC(=O)c1ccc(Nc2nc(Nc3ccc(/C=C(\C(=O)NC(C)(C)C)C(=O)OCC)cc3)nc(Nc3ccc(/C=C(\C(=O)NC(C)(C)C)C(=O)OCC)cc3)n2)cc1 |
| InChI | InChI=1S/C50H64N8O8/c1-11-15-16-32(12-2)31-66-43(61)35-21-27-38(28-22-35)53-48-55-46(51-36-23-17-33(18-24-36)29-39(44(62)64-13-3)41(59)57-49(5,6)7)54-47(56-48)52-37-25-19-34(20-26-37)30-40(45(63)65-14-4)42(60)58-50(8,9)10/h17-30,32H,11-16,31H2,1-10H3,(H,57,59)(H,58,60)(H3,51,52,53,54,55,56)/b39-29+,40-30+ |
| InChIKey | OUNYDKCVRJUXAQ-NXRKLTDKSA-N |
| XLogP | 9.20 |
| TPSA | 211.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.11 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|