C63H86N6O8 — CID 139330395
3-[2,5-di(propan-2-yl)phenyl]prop-2-enoic acid;2-ethylhexyl 4-[[4,6-bis[4-(2-ethylhexoxycarbonyl)anilino]-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 139330395) has the molecular formula C63H86N6O8 and a molecular weight of 1055.42 g/mol. Its IUPAC name is 3-[2,5-di(propan-2-yl)phenyl]prop-2-enoic acid;2-ethylhexyl 4-[[4,6-bis[4-(2-ethylhexoxycarbonyl)anilino]-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | 3-[2,5-di(propan-2-yl)phenyl]prop-2-enoic acid;2-ethylhexyl 4-[[4,6-bis[4-(2-ethylhexoxycarbonyl)anilino]-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 139330395 |
| Molecular Formula | C63H86N6O8 |
| Molecular Weight | 1055.42 g/mol |
| Exact Mass | 1054.65 |
| IUPAC Name | 3-[2,5-di(propan-2-yl)phenyl]prop-2-enoic acid;2-ethylhexyl 4-[[4,6-bis[4-(2-ethylhexoxycarbonyl)anilino]-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CC(C)c1ccc(C(C)C)c(C=CC(=O)O)c1.CCCCC(CC)COC(=O)c1ccc(Nc2nc(Nc3ccc(C(=O)OCC(CC)CCCC)cc3)nc(Nc3ccc(C(=O)OCC(CC)CCCC)cc3)n2)cc1 |
| InChI | InChI=1S/C48H66N6O6.C15H20O2/c1-7-13-16-34(10-4)31-58-43(55)37-19-25-40(26-20-37)49-46-52-47(50-41-27-21-38(22-28-41)44(56)59-32-35(11-5)17-14-8-2)54-48(53-46)51-42-29-23-39(24-30-42)45(57)60-33-36(12-6)18-15-9-3;1-10(2)12-5-7-14(11(3)4)13(9-12)6-8-15(16)17/h19-30,34-36H,7-18,31-33H2,1-6H3,(H3,49,50,51,52,53,54);5-11H,1-4H3,(H,16,17) |
| InChIKey | ZMXLBYWRHBWRRZ-UHFFFAOYSA-N |
| XLogP | 16.25 |
| TPSA | 190.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1055.42 |
| LogP ≤ 5 | 16.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|