C31H30N8O — CID 140999197
2,4-bis[4-(3-methylanilino)pyrrolo[2,3-d]pyrimidin-7-yl]pentan-3-one (PubChem CID 140999197) has the molecular formula C31H30N8O and a molecular weight of 530.64 g/mol. Its IUPAC name is 2,4-bis[4-(3-methylanilino)pyrrolo[2,3-d]pyrimidin-7-yl]pentan-3-one.
| Compound Name | 2,4-bis[4-(3-methylanilino)pyrrolo[2,3-d]pyrimidin-7-yl]pentan-3-one |
|---|---|
| PubChem CID | 140999197 |
| Molecular Formula | C31H30N8O |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 2,4-bis[4-(3-methylanilino)pyrrolo[2,3-d]pyrimidin-7-yl]pentan-3-one |
| SMILES | Cc1cccc(Nc2ncnc3c2ccn3C(C)C(=O)C(C)n2ccc3c(Nc4cccc(C)c4)ncnc32)c1 |
| InChI | InChI=1S/C31H30N8O/c1-19-7-5-9-23(15-19)36-28-25-11-13-38(30(25)34-17-32-28)21(3)27(40)22(4)39-14-12-26-29(33-18-35-31(26)39)37-24-10-6-8-20(2)16-24/h5-18,21-22H,1-4H3,(H,32,34,36)(H,33,35,37) |
| InChIKey | ZSVHPVCTTQGWIE-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 102.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |