C18H17N5 — CID 15838095
1,2-dimethyl-N-(3-methylphenyl)imidazo[4,5-g]quinazolin-8-amine (PubChem CID 15838095) has the molecular formula C18H17N5 and a molecular weight of 303.37 g/mol. Its IUPAC name is 1,2-dimethyl-N-(3-methylphenyl)imidazo[4,5-g]quinazolin-8-amine.
| Compound Name | 1,2-dimethyl-N-(3-methylphenyl)imidazo[4,5-g]quinazolin-8-amine |
|---|---|
| PubChem CID | 15838095 |
| Molecular Formula | C18H17N5 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 1,2-dimethyl-N-(3-methylphenyl)imidazo[4,5-g]quinazolin-8-amine |
| SMILES | Cc1cccc(Nc2ncnc3cc4nc(C)n(C)c4cc23)c1 |
| InChI | InChI=1S/C18H17N5/c1-11-5-4-6-13(7-11)22-18-14-8-17-16(21-12(2)23(17)3)9-15(14)19-10-20-18/h4-10H,1-3H3,(H,19,20,22) |
| InChIKey | HMCUKIPGPJEQNO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |