C16H12BN5 — CID 88972028
CID 88972028 (PubChem CID 88972028) has the molecular formula C16H12BN5 and a molecular weight of 285.12 g/mol.
| Compound Name | CID 88972028 |
|---|---|
| PubChem CID | 88972028 |
| Molecular Formula | C16H12BN5 |
| Molecular Weight | 285.12 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(Nc2ncnc3cc4c(cnn4C)cc23)c1 |
| InChI | InChI=1S/C16H12BN5/c1-22-15-7-14-13(5-10(15)8-20-22)16(19-9-18-14)21-12-4-2-3-11(17)6-12/h2-9H,1H3,(H,18,19,21) |
| InChIKey | PLXMSXDUMQTORB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.12 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|