C15H13ClN4 — CID 22460891
N-(3-ethynylphenyl)-7-methylpyrrolo[2,3-d]pyrimidin-4-amine;hydrochloride (PubChem CID 22460891) has the molecular formula C15H13ClN4 and a molecular weight of 284.75 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-7-methylpyrrolo[2,3-d]pyrimidin-4-amine;hydrochloride.
| Compound Name | N-(3-ethynylphenyl)-7-methylpyrrolo[2,3-d]pyrimidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 22460891 |
| Molecular Formula | C15H13ClN4 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-(3-ethynylphenyl)-7-methylpyrrolo[2,3-d]pyrimidin-4-amine;hydrochloride |
| SMILES | C#Cc1cccc(Nc2ncnc3c2ccn3C)c1.Cl |
| InChI | InChI=1S/C15H12N4.ClH/c1-3-11-5-4-6-12(9-11)18-14-13-7-8-19(2)15(13)17-10-16-14;/h1,4-10H,2H3,(H,16,17,18);1H |
| InChIKey | NDKPPINOPXHVPF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|