C15H13F4NO4S — CID 141000162
4-methoxy-N-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl]benzenesulfonamide (PubChem CID 141000162) has the molecular formula C15H13F4NO4S and a molecular weight of 379.33 g/mol. Its IUPAC name is 4-methoxy-N-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 141000162 |
| Molecular Formula | C15H13F4NO4S |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 4-methoxy-N-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2c(F)c(F)c(OC)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H13F4NO4S/c1-23-8-3-5-9(6-4-8)25(21,22)20-7-10-11(16)13(18)15(24-2)14(19)12(10)17/h3-6,20H,7H2,1-2H3 |
| InChIKey | OOVHXBKGOZQKED-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|