C13H20 — CID 141003335
1-[(2S)-but-3-yn-2-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 141003335) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 1-[(2S)-but-3-yn-2-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 1-[(2S)-but-3-yn-2-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 141003335 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 1-[(2S)-but-3-yn-2-yl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | C#C[C@@H](C)C1CCC2CCCCC21 |
| InChI | InChI=1S/C13H20/c1-3-10(2)12-9-8-11-6-4-5-7-13(11)12/h1,10-13H,4-9H2,2H3/t10-,11?,12?,13?/m1/s1 |
| InChIKey | XKQSWVQZHMGZRP-PEWWYSNMSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|