C12H22 — CID 22091564
1-ethyl-4-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 22091564) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is 1-ethyl-4-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 1-ethyl-4-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 22091564 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | 1-ethyl-4-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | CCC1CCC2C(C)CCCC12 |
| InChI | InChI=1S/C12H22/c1-3-10-7-8-11-9(2)5-4-6-12(10)11/h9-12H,3-8H2,1-2H3 |
| InChIKey | IEGOBVNVEIUPIL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |