C15H28 — CID 22091561
1-ethyl-2-methyl-7-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 22091561) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is 1-ethyl-2-methyl-7-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 1-ethyl-2-methyl-7-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 22091561 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | 1-ethyl-2-methyl-7-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | CCCC1CCCC2CC(C)C(CC)C12 |
| InChI | InChI=1S/C15H28/c1-4-7-12-8-6-9-13-10-11(3)14(5-2)15(12)13/h11-15H,4-10H2,1-3H3 |
| InChIKey | HQCRJDJTKUNHLF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |