C11H8N2OS — CID 14100430
6-methyl-[1,3]thiazolo[2,3-b]quinazolin-5-one (PubChem CID 14100430) has the molecular formula C11H8N2OS and a molecular weight of 216.27 g/mol. Its IUPAC name is 6-methyl-[1,3]thiazolo[2,3-b]quinazolin-5-one.
| Compound Name | 6-methyl-[1,3]thiazolo[2,3-b]quinazolin-5-one |
|---|---|
| PubChem CID | 14100430 |
| Molecular Formula | C11H8N2OS |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 6-methyl-[1,3]thiazolo[2,3-b]quinazolin-5-one |
| SMILES | Cc1cccc2nc3sccn3c(=O)c12 |
| InChI | InChI=1S/C11H8N2OS/c1-7-3-2-4-8-9(7)10(14)13-5-6-15-11(13)12-8/h2-6H,1H3 |
| InChIKey | LMHCAPMNQXJMEM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |