C38H46N4O4 — CID 141004393
1-N,1-N,2-N,2-N-tetrakis(4-methoxy-2,6-dimethylphenyl)ethanediimidamide (PubChem CID 141004393) has the molecular formula C38H46N4O4 and a molecular weight of 622.81 g/mol. Its IUPAC name is 1-N,1-N,2-N,2-N-tetrakis(4-methoxy-2,6-dimethylphenyl)ethanediimidamide.
| Compound Name | 1-N,1-N,2-N,2-N-tetrakis(4-methoxy-2,6-dimethylphenyl)ethanediimidamide |
|---|---|
| PubChem CID | 141004393 |
| Molecular Formula | C38H46N4O4 |
| Molecular Weight | 622.81 g/mol |
| Exact Mass | 622.35 |
| IUPAC Name | 1-N,1-N,2-N,2-N-tetrakis(4-methoxy-2,6-dimethylphenyl)ethanediimidamide |
| SMILES | [H]/N=C(C(=N/[H])\N(c1c(C)cc(OC)cc1C)c1c(C)cc(OC)cc1C)/N(c1c(C)cc(OC)cc1C)c1c(C)cc(OC)cc1C |
| InChI | InChI=1S/C38H46N4O4/c1-21-13-29(43-9)14-22(2)33(21)41(34-23(3)15-30(44-10)16-24(34)4)37(39)38(40)42(35-25(5)17-31(45-11)18-26(35)6)36-27(7)19-32(46-12)20-28(36)8/h13-20,39-40H,1-12H3/b39-37+,40-38+ |
| InChIKey | ZLYNBTGBCPROPX-HVMBLDELSA-N |
| XLogP | 9.12 |
| TPSA | 91.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.81 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|