C18H13N5OS — CID 141004623
5-(furan-2-yl)-3-(1H-imidazol-2-yl)-1-(1H-pyrrol-2-yl)-4-thiophen-2-ylpyrazole (PubChem CID 141004623) has the molecular formula C18H13N5OS and a molecular weight of 347.40 g/mol. Its IUPAC name is 5-(furan-2-yl)-3-(1H-imidazol-2-yl)-1-(1H-pyrrol-2-yl)-4-thiophen-2-ylpyrazole.
| Compound Name | 5-(furan-2-yl)-3-(1H-imidazol-2-yl)-1-(1H-pyrrol-2-yl)-4-thiophen-2-ylpyrazole |
|---|---|
| PubChem CID | 141004623 |
| Molecular Formula | C18H13N5OS |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 5-(furan-2-yl)-3-(1H-imidazol-2-yl)-1-(1H-pyrrol-2-yl)-4-thiophen-2-ylpyrazole |
| SMILES | c1c[nH]c(-n2nc(-c3ncc[nH]3)c(-c3cccs3)c2-c2ccco2)c1 |
| InChI | InChI=1S/C18H13N5OS/c1-6-14(19-7-1)23-17(12-4-2-10-24-12)15(13-5-3-11-25-13)16(22-23)18-20-8-9-21-18/h1-11,19H,(H,20,21) |
| InChIKey | ZHMNEPUMIOAOFX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |