C22H22N4O — CID 141004998
3-[4-(7-tert-butylpyrrolo[2,3-d]pyrimidin-5-yl)phenoxy]aniline (PubChem CID 141004998) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is 3-[4-(7-tert-butylpyrrolo[2,3-d]pyrimidin-5-yl)phenoxy]aniline.
| Compound Name | 3-[4-(7-tert-butylpyrrolo[2,3-d]pyrimidin-5-yl)phenoxy]aniline |
|---|---|
| PubChem CID | 141004998 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 3-[4-(7-tert-butylpyrrolo[2,3-d]pyrimidin-5-yl)phenoxy]aniline |
| SMILES | CC(C)(C)n1cc(-c2ccc(Oc3cccc(N)c3)cc2)c2cncnc21 |
| InChI | InChI=1S/C22H22N4O/c1-22(2,3)26-13-20(19-12-24-14-25-21(19)26)15-7-9-17(10-8-15)27-18-6-4-5-16(23)11-18/h4-14H,23H2,1-3H3 |
| InChIKey | IVGWSJIHVWPRFY-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|