C10H23Cl2N5O — CID 141006486
N,2-di(piperazin-1-yl)acetamide;dihydrochloride (PubChem CID 141006486) has the molecular formula C10H23Cl2N5O and a molecular weight of 300.23 g/mol. Its IUPAC name is N,2-di(piperazin-1-yl)acetamide;dihydrochloride.
| Compound Name | N,2-di(piperazin-1-yl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 141006486 |
| Molecular Formula | C10H23Cl2N5O |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N,2-di(piperazin-1-yl)acetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CN1CCNCC1)NN1CCNCC1 |
| InChI | InChI=1S/C10H21N5O.2ClH/c16-10(9-14-5-1-11-2-6-14)13-15-7-3-12-4-8-15;;/h11-12H,1-9H2,(H,13,16);2*1H |
| InChIKey | BJIZCXDIOOYBTB-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |