C16H37N7O2 — CID 158301673
methane;N-methyl-2-(4-methylpiperazin-1-yl)acetamide;2-(4-methylpiperazin-1-yl)acetohydrazide (PubChem CID 158301673) has the molecular formula C16H37N7O2 and a molecular weight of 359.52 g/mol. Its IUPAC name is methane;N-methyl-2-(4-methylpiperazin-1-yl)acetamide;2-(4-methylpiperazin-1-yl)acetohydrazide.
| Compound Name | methane;N-methyl-2-(4-methylpiperazin-1-yl)acetamide;2-(4-methylpiperazin-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 158301673 |
| Molecular Formula | C16H37N7O2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.30 |
| IUPAC Name | methane;N-methyl-2-(4-methylpiperazin-1-yl)acetamide;2-(4-methylpiperazin-1-yl)acetohydrazide |
| SMILES | C.CN1CCN(CC(=O)NN)CC1.CNC(=O)CN1CCN(C)CC1 |
| InChI | InChI=1S/C8H17N3O.C7H16N4O.CH4/c1-9-8(12)7-11-5-3-10(2)4-6-11;1-10-2-4-11(5-3-10)6-7(12)9-8;/h3-7H2,1-2H3,(H,9,12);2-6,8H2,1H3,(H,9,12);1H4 |
| InChIKey | GMOLUXKVGHSLOC-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|