About 2-methoxy-1-(1-methoxypentan-3-yl)imidazo[4,5-c]pyridine
2-methoxy-1-(1-methoxypentan-3-yl)imidazo[4,5-c]pyridine (PubChem CID 141006902) has the molecular formula C13H19N3O2
and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-methoxy-1-(1-methoxypentan-3-yl)imidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 2-methoxy-1-(1-methoxypentan-3-yl)imidazo[4,5-c]pyridine |
| PubChem CID | 141006902 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-methoxy-1-(1-methoxypentan-3-yl)imidazo[4,5-c]pyridine |
| SMILES | CCC(CCOC)n1c(OC)nc2cnccc21 |
| InChI | InChI=1S/C13H19N3O2/c1-4-10(6-8-17-2)16-12-5-7-14-9-11(12)15-13(16)18-3/h5,7,9-10H,4,6,8H2,1-3H3 |
| InChIKey | VAXCLRMDYKFMTM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methoxy-1-(1-methoxypentan-3-yl)imidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1-(1-methoxypentan-3-yl)imidazo[4,5-c]pyridine?
The IUPAC name of 2-methoxy-1-(1-methoxypentan-3-yl)imidazo[4,5-c]pyridine (CID 141006902) is 2-methoxy-1-(1-methoxypentan-3-yl)imidazo[4,5-c]pyridine.
What is the SMILES notation for 2-methoxy-1-(1-methoxypentan-3-yl)imidazo[4,5-c]pyridine?
The canonical SMILES for 2-methoxy-1-(1-methoxypentan-3-yl)imidazo[4,5-c]pyridine is CCC(CCOC)n1c(OC)nc2cnccc21.
What is the InChIKey of 2-methoxy-1-(1-methoxypentan-3-yl)imidazo[4,5-c]pyridine?
The InChIKey is VAXCLRMDYKFMTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2/c1-4-10(6-8-17-2)16-12-5-7-14-9-11(12)15-13(16)18-3/h5,7,9-10H,4,6,8H2,1-3H3.
What are the key properties of 2-methoxy-1-(1-methoxypentan-3-yl)imidazo[4,5-c]pyridine?
2-methoxy-1-(1-methoxypentan-3-yl)imidazo[4,5-c]pyridine has a molecular weight of 249.31 g/mol, XLogP of 2.43, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1-(1-methoxypentan-3-yl)imidazo[4,5-c]pyridine is sourced from PubChem (CID 141006902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).