C11H16N4O — CID 79295990
1-(1-methoxybutan-2-yl)imidazo[4,5-c]pyridin-2-amine (PubChem CID 79295990) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 1-(1-methoxybutan-2-yl)imidazo[4,5-c]pyridin-2-amine.
| Compound Name | 1-(1-methoxybutan-2-yl)imidazo[4,5-c]pyridin-2-amine |
|---|---|
| PubChem CID | 79295990 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 1-(1-methoxybutan-2-yl)imidazo[4,5-c]pyridin-2-amine |
| SMILES | CCC(COC)n1c(N)nc2cnccc21 |
| InChI | InChI=1S/C11H16N4O/c1-3-8(7-16-2)15-10-4-5-13-6-9(10)14-11(15)12/h4-6,8H,3,7H2,1-2H3,(H2,12,14) |
| InChIKey | GTXAOTFDINJNPA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |