C14H22N4 — CID 114137698
1-octan-4-ylimidazo[4,5-c]pyridin-2-amine (PubChem CID 114137698) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is 1-octan-4-ylimidazo[4,5-c]pyridin-2-amine.
| Compound Name | 1-octan-4-ylimidazo[4,5-c]pyridin-2-amine |
|---|---|
| PubChem CID | 114137698 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 1-octan-4-ylimidazo[4,5-c]pyridin-2-amine |
| SMILES | CCCCC(CCC)n1c(N)nc2cnccc21 |
| InChI | InChI=1S/C14H22N4/c1-3-5-7-11(6-4-2)18-13-8-9-16-10-12(13)17-14(18)15/h8-11H,3-7H2,1-2H3,(H2,15,17) |
| InChIKey | IUVKTCLMDVBLCH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |