C21H13Cl2NO3S — CID 141010415
3-chloro-N-(4-chlorophenyl)-N-(3,4-dihydroxyphenyl)-1-benzothiophene-2-carboxamide (PubChem CID 141010415) has the molecular formula C21H13Cl2NO3S and a molecular weight of 430.31 g/mol. Its IUPAC name is 3-chloro-N-(4-chlorophenyl)-N-(3,4-dihydroxyphenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(4-chlorophenyl)-N-(3,4-dihydroxyphenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 141010415 |
| Molecular Formula | C21H13Cl2NO3S |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | 3-chloro-N-(4-chlorophenyl)-N-(3,4-dihydroxyphenyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(c1sc2ccccc2c1Cl)N(c1ccc(Cl)cc1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H13Cl2NO3S/c22-12-5-7-13(8-6-12)24(14-9-10-16(25)17(26)11-14)21(27)20-19(23)15-3-1-2-4-18(15)28-20/h1-11,25-26H |
| InChIKey | VHQLIUPLPUFMAE-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|