C17H16F17NO3S — CID 141010461
ethyl 2-[butyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfinyl)amino]prop-2-enoate (PubChem CID 141010461) has the molecular formula C17H16F17NO3S and a molecular weight of 637.35 g/mol. Its IUPAC name is ethyl 2-[butyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfinyl)amino]prop-2-enoate.
| Compound Name | ethyl 2-[butyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfinyl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 141010461 |
| Molecular Formula | C17H16F17NO3S |
| Molecular Weight | 637.35 g/mol |
| Exact Mass | 637.06 |
| IUPAC Name | ethyl 2-[butyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfinyl)amino]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)N(CCCC)S(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H16F17NO3S/c1-4-6-7-35(8(3)9(36)38-5-2)39(37)17(33,34)15(28,29)13(24,25)11(20,21)10(18,19)12(22,23)14(26,27)16(30,31)32/h3-7H2,1-2H3 |
| InChIKey | NNVZDURRWWFFSZ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.35 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|