C14H16N10O8 — CID 141013391
1-carbamoyl-3-[6-[[carbamoyl(isocyanato)carbamoyl]-isocyanatoamino]hexyl]-1,3-diisocyanatourea (PubChem CID 141013391) has the molecular formula C14H16N10O8 and a molecular weight of 452.34 g/mol. Its IUPAC name is 1-carbamoyl-3-[6-[[carbamoyl(isocyanato)carbamoyl]-isocyanatoamino]hexyl]-1,3-diisocyanatourea.
| Compound Name | 1-carbamoyl-3-[6-[[carbamoyl(isocyanato)carbamoyl]-isocyanatoamino]hexyl]-1,3-diisocyanatourea |
|---|---|
| PubChem CID | 141013391 |
| Molecular Formula | C14H16N10O8 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 1-carbamoyl-3-[6-[[carbamoyl(isocyanato)carbamoyl]-isocyanatoamino]hexyl]-1,3-diisocyanatourea |
| SMILES | NC(=O)N(N=C=O)C(=O)N(CCCCCCN(N=C=O)C(=O)N(N=C=O)C(N)=O)N=C=O |
| InChI | InChI=1S/C14H16N10O8/c15-11(29)23(19-9-27)13(31)21(17-7-25)5-3-1-2-4-6-22(18-8-26)14(32)24(12(16)30)20-10-28/h1-6H2,(H2,15,29)(H2,16,30) |
| InChIKey | UZJIMIDHYKYPNH-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 251.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|