About 1-chloro-1-hexylurea
1-chloro-1-hexylurea (PubChem CID 175264526) has the molecular formula C7H15ClN2O
and a molecular weight of 178.66 g/mol. Its IUPAC name is 1-chloro-1-hexylurea.
Molecular Properties
| Compound Name | 1-chloro-1-hexylurea |
| PubChem CID | 175264526 |
| Molecular Formula | C7H15ClN2O |
| Molecular Weight | 178.66 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 1-chloro-1-hexylurea |
| SMILES | CCCCCCN(Cl)C(N)=O |
| InChI | InChI=1S/C7H15ClN2O/c1-2-3-4-5-6-10(8)7(9)11/h2-6H2,1H3,(H2,9,11) |
| InChIKey | WAVGFGIGRDIKME-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.66 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-1-hexylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1-hexylurea?
The IUPAC name of 1-chloro-1-hexylurea (CID 175264526) is 1-chloro-1-hexylurea.
What is the SMILES notation for 1-chloro-1-hexylurea?
The canonical SMILES for 1-chloro-1-hexylurea is CCCCCCN(Cl)C(N)=O.
What is the InChIKey of 1-chloro-1-hexylurea?
The InChIKey is WAVGFGIGRDIKME-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15ClN2O/c1-2-3-4-5-6-10(8)7(9)11/h2-6H2,1H3,(H2,9,11).
What are the key properties of 1-chloro-1-hexylurea?
1-chloro-1-hexylurea has a molecular weight of 178.66 g/mol, XLogP of 2.10, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1-hexylurea is sourced from PubChem (CID 175264526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).