About 1-dodecyl-1-sulfanylurea
1-dodecyl-1-sulfanylurea (PubChem CID 57291186) has the molecular formula C13H28N2OS
and a molecular weight of 260.45 g/mol. Its IUPAC name is 1-dodecyl-1-sulfanylurea.
Molecular Properties
| Compound Name | 1-dodecyl-1-sulfanylurea |
| PubChem CID | 57291186 |
| Molecular Formula | C13H28N2OS |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 1-dodecyl-1-sulfanylurea |
| SMILES | CCCCCCCCCCCCN(S)C(N)=O |
| InChI | InChI=1S/C13H28N2OS/c1-2-3-4-5-6-7-8-9-10-11-12-15(17)13(14)16/h17H,2-12H2,1H3,(H2,14,16) |
| InChIKey | OSXARHFBSNQSSH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-dodecyl-1-sulfanylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-dodecyl-1-sulfanylurea?
The IUPAC name of 1-dodecyl-1-sulfanylurea (CID 57291186) is 1-dodecyl-1-sulfanylurea.
What is the SMILES notation for 1-dodecyl-1-sulfanylurea?
The canonical SMILES for 1-dodecyl-1-sulfanylurea is CCCCCCCCCCCCN(S)C(N)=O.
What is the InChIKey of 1-dodecyl-1-sulfanylurea?
The InChIKey is OSXARHFBSNQSSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2OS/c1-2-3-4-5-6-7-8-9-10-11-12-15(17)13(14)16/h17H,2-12H2,1H3,(H2,14,16).
What are the key properties of 1-dodecyl-1-sulfanylurea?
1-dodecyl-1-sulfanylurea has a molecular weight of 260.45 g/mol, XLogP of 4.13, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-dodecyl-1-sulfanylurea is sourced from PubChem (CID 57291186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).