C14H7NO3 — CID 141014561
4,14-dioxa-17-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,5,7,9,11,15-heptaen-13-one (PubChem CID 141014561) has the molecular formula C14H7NO3 and a molecular weight of 237.21 g/mol. Its IUPAC name is 4,14-dioxa-17-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,5,7,9,11,15-heptaen-13-one.
| Compound Name | 4,14-dioxa-17-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,5,7,9,11,15-heptaen-13-one |
|---|---|
| PubChem CID | 141014561 |
| Molecular Formula | C14H7NO3 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 4,14-dioxa-17-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1(17),2,5,7,9,11,15-heptaen-13-one |
| SMILES | O=c1occ2nc3cc4occcc4cc3cc12 |
| InChI | InChI=1S/C14H7NO3/c16-14-10-5-9-4-8-2-1-3-17-13(8)6-11(9)15-12(10)7-18-14/h1-7H |
| InChIKey | FMSJWDDGPGSJHS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|