C11H16N2O4S — CID 141014779
1,1-dihydroxy-2-[(4-nitrophenyl)methyl]-1,4-thiazinane (PubChem CID 141014779) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is 1,1-dihydroxy-2-[(4-nitrophenyl)methyl]-1,4-thiazinane.
| Compound Name | 1,1-dihydroxy-2-[(4-nitrophenyl)methyl]-1,4-thiazinane |
|---|---|
| PubChem CID | 141014779 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1,1-dihydroxy-2-[(4-nitrophenyl)methyl]-1,4-thiazinane |
| SMILES | O=[N+]([O-])c1ccc(CC2CNCCS2(O)O)cc1 |
| InChI | InChI=1S/C11H16N2O4S/c14-13(15)10-3-1-9(2-4-10)7-11-8-12-5-6-18(11,16)17/h1-4,11-12,16-17H,5-8H2 |
| InChIKey | GHCSDWLKDDEVOC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|