C13H21N5O2 — CID 19853699
3-[(4-nitrophenyl)methyl]-1,2,5,8-tetrazecane (PubChem CID 19853699) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-[(4-nitrophenyl)methyl]-1,2,5,8-tetrazecane.
| Compound Name | 3-[(4-nitrophenyl)methyl]-1,2,5,8-tetrazecane |
|---|---|
| PubChem CID | 19853699 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 3-[(4-nitrophenyl)methyl]-1,2,5,8-tetrazecane |
| SMILES | O=[N+]([O-])c1ccc(CC2CNCCNCCNN2)cc1 |
| InChI | InChI=1S/C13H21N5O2/c19-18(20)13-3-1-11(2-4-13)9-12-10-15-6-5-14-7-8-16-17-12/h1-4,12,14-17H,5-10H2 |
| InChIKey | IJUKQLQCAFNWMU-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|