About 4-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;dihydrochloride
4-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;dihydrochloride (PubChem CID 141015609) has the molecular formula C7H9Cl2NO3S
and a molecular weight of 258.13 g/mol. Its IUPAC name is 4-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;dihydrochloride.
Molecular Properties
| Compound Name | 4-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;dihydrochloride |
| PubChem CID | 141015609 |
| Molecular Formula | C7H9Cl2NO3S |
| Molecular Weight | 258.13 g/mol |
| Exact Mass | 256.97 |
| IUPAC Name | 4-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;dihydrochloride |
| SMILES | Cl.Cl.O=C1C=C(C(=O)O)N2CCC2S1 |
| InChI | InChI=1S/C7H7NO3S.2ClH/c9-6-3-4(7(10)11)8-2-1-5(8)12-6;;/h3,5H,1-2H2,(H,10,11);2*1H |
| InChIKey | IURZIXQUBDCIEQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.13 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;dihydrochloride?
The IUPAC name of 4-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;dihydrochloride (CID 141015609) is 4-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;dihydrochloride.
What is the SMILES notation for 4-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;dihydrochloride?
The canonical SMILES for 4-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;dihydrochloride is Cl.Cl.O=C1C=C(C(=O)O)N2CCC2S1.
What is the InChIKey of 4-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;dihydrochloride?
The InChIKey is IURZIXQUBDCIEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3S.2ClH/c9-6-3-4(7(10)11)8-2-1-5(8)12-6;;/h3,5H,1-2H2,(H,10,11);2*1H.
What are the key properties of 4-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;dihydrochloride?
4-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;dihydrochloride has a molecular weight of 258.13 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;dihydrochloride is sourced from PubChem (CID 141015609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).