C21H26O2 — CID 141021386
9,9-bis(methoxymethyl)-2-(2-methylpropyl)fluorene (PubChem CID 141021386) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 9,9-bis(methoxymethyl)-2-(2-methylpropyl)fluorene.
| Compound Name | 9,9-bis(methoxymethyl)-2-(2-methylpropyl)fluorene |
|---|---|
| PubChem CID | 141021386 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 9,9-bis(methoxymethyl)-2-(2-methylpropyl)fluorene |
| SMILES | COCC1(COC)c2ccccc2-c2ccc(CC(C)C)cc21 |
| InChI | InChI=1S/C21H26O2/c1-15(2)11-16-9-10-18-17-7-5-6-8-19(17)21(13-22-3,14-23-4)20(18)12-16/h5-10,12,15H,11,13-14H2,1-4H3 |
| InChIKey | PDAPAWRFCGSFPK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |