C21H20FNO6 — CID 141024780
5-[[3-[1-(5-fluoro-2-methoxyphenyl)cyclopropyl]-2-oxopropanoyl]amino]-2-(hydroxymethyl)benzoic acid (PubChem CID 141024780) has the molecular formula C21H20FNO6 and a molecular weight of 401.39 g/mol. Its IUPAC name is 5-[[3-[1-(5-fluoro-2-methoxyphenyl)cyclopropyl]-2-oxopropanoyl]amino]-2-(hydroxymethyl)benzoic acid.
| Compound Name | 5-[[3-[1-(5-fluoro-2-methoxyphenyl)cyclopropyl]-2-oxopropanoyl]amino]-2-(hydroxymethyl)benzoic acid |
|---|---|
| PubChem CID | 141024780 |
| Molecular Formula | C21H20FNO6 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 5-[[3-[1-(5-fluoro-2-methoxyphenyl)cyclopropyl]-2-oxopropanoyl]amino]-2-(hydroxymethyl)benzoic acid |
| SMILES | COc1ccc(F)cc1C1(CC(=O)C(=O)Nc2ccc(CO)c(C(=O)O)c2)CC1 |
| InChI | InChI=1S/C21H20FNO6/c1-29-18-5-3-13(22)8-16(18)21(6-7-21)10-17(25)19(26)23-14-4-2-12(11-24)15(9-14)20(27)28/h2-5,8-9,24H,6-7,10-11H2,1H3,(H,23,26)(H,27,28) |
| InChIKey | TXXSSBZMYAYCKK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|